View source for MediaWiki/ChemBox1

{{chembox
|   Name = Caffeine
|   ImageFileL1 = Caffeine--.gif 
|   ImageSizeL1 = 100px 
|   ImageNameL1 = Hybrid skeletal structure of the caffeine molecule
|   ImageFileR1 = Caffeine-3D--.gif 
|   ImageSizeR1 = 145px 
|   ImageNameR1 = Space-filling model of the caffeine molecule 
|   IUPACName = 1,3,7-trimethyl- 1''H''-purine- 2,6(3''H'',7''H'')-dione 
|   OtherNames = 1,3,7-trimethylxanthine, trimethylxanthine,<br />theine, methyltheobromine 
| Section1 = {{Chembox Identifiers
|   SMILES = C[n]1cnc2N(C)C(=O)N(C)C(=O)c12 
|   CASNo = 58-08-2
|    CASNo_Ref = 
|   ChemSpiderID = 2424
|   RTECS = EV6475000 
  }}
| Section2 = {{Chembox Structure
| 3DStruct = Caffeine.mol
| CrystalStruct = 
| Coordination = 
| MolShape = mostly planar
  }}
}}

This a duplicate of (part of) the [http://en.wikipedia.org/wiki/Template:Chembox ChemBox template used at Wikipedia], with an added item, '3D structure' inside the 'Structure' section.
The link is inserted using standard syntax of the ChemBox template, that includes a parameter with the filename (that's why the link text is the same as the filename, just simplifying things).
The link opens a small, resizable browser window (a pop-up, but only by user's action, so it should not be blocked by pop-up-blocker software) with the JmolApplet that covers the full window and resizes with it.

(Images are not working temporarily, but under normal conditions should be there at the top row of the ChemBox).