Difference between revisions of "User:AngelHerraez/Sandbox/Caffeine"
< User:AngelHerraez | Sandbox
Jump to navigation
Jump to search
AngelHerraez (talk | contribs) |
AngelHerraez (talk | contribs) (reviving this test page (images now work)) |
||
| (6 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
{{chembox | {{chembox | ||
| Name = Caffeine | | Name = Caffeine | ||
| − | | ImageFileL1 = Caffeine. | + | | ImageFileL1 = Caffeine.png |
| ImageSizeL1 = 100px | | ImageSizeL1 = 100px | ||
| ImageNameL1 = Hybrid skeletal structure of the caffeine molecule | | ImageNameL1 = Hybrid skeletal structure of the caffeine molecule | ||
| − | | ImageFileR1 = Caffeine-3D | + | | ImageFileR1 = Caffeine-3D.png |
| ImageSizeR1 = 145px | | ImageSizeR1 = 145px | ||
| ImageNameR1 = Space-filling model of the caffeine molecule | | ImageNameR1 = Space-filling model of the caffeine molecule | ||
| − | |||
| − | |||
| − | |||
| IUPACName = 1,3,7-trimethyl- 1''H''-purine- 2,6(3''H'',7''H'')-dione | | IUPACName = 1,3,7-trimethyl- 1''H''-purine- 2,6(3''H'',7''H'')-dione | ||
| OtherNames = 1,3,7-trimethylxanthine, trimethylxanthine,<br />theine, methyltheobromine | | OtherNames = 1,3,7-trimethylxanthine, trimethylxanthine,<br />theine, methyltheobromine | ||
| − | | Section1 | + | | Section1 = {{Chembox Identifiers |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| SMILES = C[n]1cnc2N(C)C(=O)N(C)C(=O)c12 | | SMILES = C[n]1cnc2N(C)C(=O)N(C)C(=O)c12 | ||
| CASNo = 58-08-2 | | CASNo = 58-08-2 | ||
| Line 25: | Line 16: | ||
| RTECS = EV6475000 | | RTECS = EV6475000 | ||
}} | }} | ||
| − | | | + | | Section2 = {{Chembox Structure |
| − | | | + | | 3DStruct = Caffeine.mol |
| − | + | | CrystalStruct = | |
| − | | | + | | Coordination = |
| − | + | | MolShape = mostly planar | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | | | ||
| − | | | ||
| − | |||
| − | |||
}} | }} | ||
}} | }} | ||
| + | |||
| + | This a duplicate of (part of) the ChemBox template used at Wikipedia, with an added item, '3D structure' inside the 'Structure' section. | ||
| + | The link is inserted using standard syntax of the ChemBox template, that includes a parameter with the filename (that's why the link text is the same as the filename, just simplifying things). | ||
| + | The link opens a small, resizable browser window (a pop-up, but only by user's action, so it should not be blocked by pop-up-blocker software) with the JmolApplet that covers the full window and resizes with it. | ||
Latest revision as of 19:51, 13 October 2010
| Caffeine | |
|---|---|
| IUPAC name | |
| Other names | 1,3,7-trimethylxanthine, trimethylxanthine, theine, methyltheobromine |
| Identifiers | |
| CAS number | [] |
| RTECS number | EV6475000 |
| SMILES | |
| ChemSpider ID | |
| Structure | |
| 3D structure | |
| Molecular shape | mostly planar |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox references | |
This a duplicate of (part of) the ChemBox template used at Wikipedia, with an added item, '3D structure' inside the 'Structure' section. The link is inserted using standard syntax of the ChemBox template, that includes a parameter with the filename (that's why the link text is the same as the filename, just simplifying things). The link opens a small, resizable browser window (a pop-up, but only by user's action, so it should not be blocked by pop-up-blocker software) with the JmolApplet that covers the full window and resizes with it.